![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| trans-p-anisalacetop..> | 2024-08-21 18:47 | 91K | |
| start spring info.htm | 2025-01-07 13:53 | 65K | |
| questprint_files/ | 2024-01-05 15:05 | - | |
| questprint.htm | 2024-08-21 18:47 | 44K | |
| fphoverx.class | 2024-08-21 18:47 | 1.4K | |
| fphover.class | 2024-08-21 18:47 | 9.1K | |
| _vti_cnf/ | 2013-05-14 12:42 | - | |
| WS_FTP.LOG | 2024-08-21 18:47 | 5.6K | |
| Videos_files/ | 2024-01-05 15:05 | - | |
| Videos.htm | 2024-08-21 18:47 | 48K | |
| Taking a Melting Poi..> | 2024-08-21 18:47 | 100K | |
| Table 1 Retention Ti..> | 2024-08-21 18:47 | 12K | |
| Synthesis of Methyl ..> | 2024-08-21 18:47 | 24K | |
| Reflux.htm | 2024-08-21 18:47 | 45K | |
| Reduction and Aldol ..> | 2024-08-21 18:47 | 29K | |
| Quest_files/ | 2024-01-05 15:05 | - | |
| Quest.htm | 2024-08-21 18:47 | 45K | |
| PreLabs.pdf | 2024-08-21 18:47 | 316K | |
| Organic Molecule Rep..> | 2024-08-21 18:47 | 12K | |
| Organic Molecule Rep..> | 2024-08-21 18:47 | 26K | |
| New folder/ | 2024-01-05 15:05 | - | |
| Methyl Benzoate.jpg | 2024-08-21 18:47 | 74K | |
| Luminol Procedure fo..> | 2024-08-21 18:47 | 26K | |
| Luminol Data.doc | 2024-08-21 18:47 | 27K | |
| Lectures_files/ | 2024-01-05 15:05 | - | |
| Lectures.htm | 2024-08-21 18:47 | 52K | |
| Lacreek.zip | 2024-06-01 10:12 | 462M | |
| IR_files/ | 2018-07-23 14:03 | - | |
| IR Spectroscopy Tuto..> | 2018-07-16 11:06 | - | |
| IR Spectroscopy Tuto..> | 2024-08-21 18:47 | 74K | |
| IR Spectroscopy Tuto..> | 2018-07-23 14:03 | - | |
| IR Spectroscopy Tuto..> | 2024-08-21 18:47 | 74K | |
| IR Spectroscopy Tuto..> | 2024-08-21 18:47 | 14K | |
| IR 2-chloro-2-methyl..> | 2024-08-21 18:47 | 51K | |
| IR.htm | 2024-08-21 18:47 | 44K | |
| How to Write a Post ..> | 2024-08-21 18:47 | 14K | |
| Gas Chromatography D..> | 2024-08-21 18:47 | 46K | |
| GC Rention Times.pdf | 2024-08-21 18:47 | 206K | |
| GC Rention Times.docx | 2024-08-21 18:47 | 245K | |
| GC Data_files/ | 2017-09-06 12:21 | - | |
| GC Data.htm | 2024-08-21 18:47 | 77K | |
| GC Data.docx | 2024-08-21 18:47 | 88K | |
| Fraction C.pdf | 2024-08-21 18:47 | 24K | |
| Fraction C + Toluene..> | 2024-08-21 18:47 | 25K | |
| Fraction B.pdf | 2024-08-21 18:47 | 25K | |
| Fraction A.pdf | 2024-08-21 18:47 | 25K | |
| Fraction A + Cyclohe..> | 2024-08-21 18:47 | 26K | |
| For those in section..> | 2024-08-21 18:47 | 26K | |
| Figures/ | 2017-07-05 14:58 | - | |
| Extraction and Stere..> | 2024-08-21 18:47 | 13K | |
| Extraction Progressi..> | 2024-08-21 18:47 | 441K | |
| Electrophilic Data.htm | 2024-08-21 18:47 | 29K | |
| Data for Substitutio..> | 2024-08-21 18:47 | 26K | |
| Bromobenzene.docx | 2024-08-21 18:47 | 85K | |
| Bromination of Arene..> | 2024-08-21 18:47 | 12K | |
| 210c_files/ | 2015-03-05 19:25 | - | |
| 210c.htm | 2025-03-24 20:07 | 49K | |
| 118maj_files/ | 2024-01-05 15:05 | - | |
| 118maj.htm | 2024-08-21 18:47 | 47K | |
| 118l_files/ | 2013-05-14 12:42 | - | |
| 118l.htm | 2025-01-07 17:06 | 48K | |
| 118k_files/ | 2013-05-14 12:42 | - | |
| 118k.htm | 2025-04-15 10:45 | 47K | |
| α.doc | 2024-08-21 18:47 | 27K | |