![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Fluorenone.pdf | 2025-10-30 11:18 | 175K | |
| Fluorenone.docx | 2025-10-30 11:18 | 58K | |
| EAS 220C.pdf | 2025-10-29 14:24 | 161K | |
| EAS 220C.docx | 2025-10-29 14:24 | 17K | |
| Peptide day 2.pdf | 2025-10-27 11:25 | 113K | |
| Peptide day 2.docx | 2025-10-27 11:25 | 15K | |
| Kinetics Vs Thermody..> | 2025-09-08 18:22 | 117K | |
| Kinetics Vs Thermody..> | 2025-09-08 18:22 | 16K | |
| Titration.pdf | 2025-09-08 18:14 | 692K | |
| Unknown Grignard Pro..> | 2025-09-08 18:13 | 71K | |
| Titration.docx | 2025-09-08 18:12 | 970K | |
| Stilbene.docx | 2025-09-08 18:12 | 489K | |
| Stilbene.pdf | 2025-09-08 18:12 | 193K | |
| Procedure for Column..> | 2025-09-08 18:12 | 208K | |
| Stereochemistry Proc..> | 2025-09-08 18:12 | 11K | |
| Stereochemistry Proc..> | 2025-09-08 18:12 | 15K | |
| Reduction of Methyl ..> | 2025-09-08 18:12 | 10K | |
| Reduction of Methyl ..> | 2025-09-08 18:12 | 15K | |
| Peptide Day 4.pdf | 2025-09-08 18:12 | 40K | |
| Polymers Procedure.pdf | 2025-09-08 18:12 | 87K | |
| Polymers Procedure.docx | 2025-09-08 18:12 | 14K | |
| Polymers Procedure o..> | 2025-09-08 18:12 | 11K | |
| Peptide Synthesis Pr..> | 2025-09-08 18:12 | 17K | |
| Peptide Day 4.docx | 2025-09-08 18:12 | 14K | |
| Peptide Day 3.pdf | 2025-09-08 18:12 | 64K | |
| Peptide Day 3.docx | 2025-09-08 18:12 | 15K | |
| Old Luminol Procedur..> | 2025-09-08 18:12 | 230K | |
| Peptide day 1.pdf | 2025-09-08 18:12 | 97K | |
| Peptide day 1.docx | 2025-09-08 18:12 | 15K | |
| Peptide day 1 edit.docx | 2025-09-08 18:12 | 15K | |
| Oxidation.pdf | 2025-09-08 18:12 | 13K | |
| Oxidation.docx | 2025-09-08 18:12 | 15K | |
| Old Luminol Procedur..> | 2025-09-08 18:12 | 62K | |
| Nucleophilic Substit..> | 2025-09-08 18:12 | 96K | |
| Nucleophilic Substit..> | 2025-09-08 18:12 | 77K | |
| Luminol Procedure.pdf | 2025-09-08 18:12 | 214K | |
| new Grignard Procedu..> | 2025-09-08 18:12 | 70K | |
| New Fischer Esterifi..> | 2025-09-08 18:12 | 106K | |
| New Fischer Esterifi..> | 2025-09-08 18:12 | 15K | |
| Luminol Procedure.docx | 2025-09-08 18:12 | 63K | |
| Kinetics Vs Thermody..> | 2025-09-08 18:12 | 17K | |
| Kinetics Vs Thermody..> | 2025-09-08 18:12 | 16K | |
| Hydration of Norborn..> | 2025-09-08 18:12 | 444K | |
| Hydroboration of Pin..> | 2025-09-08 18:12 | 189K | |
| Hydroboration of Pin..> | 2025-09-08 18:12 | 330K | |
| Hydration of Norborn..> | 2025-09-08 18:12 | 166K | |
| Hydration of Norborn..> | 2025-09-08 18:11 | 444K | |
| Hydration of Norborn..> | 2025-09-08 18:11 | 166K | |
| Fractional Distillat..> | 2025-09-08 18:11 | 300K | |
| Halide Tests for Nuc..> | 2025-09-08 18:11 | 23K | |
| Halide Tests for Nuc..> | 2025-09-08 18:11 | 14K | |
| Grignard Procedure.pdf | 2025-09-08 18:11 | 271K | |
| Grignard Procedure.docx | 2025-09-08 18:10 | 123K | |
| Fractional Distillat..> | 2025-09-08 18:10 | 570K | |
| Distillation Printab..> | 2025-09-08 18:10 | 665K | |
| Fischer Esterificati..> | 2025-09-08 18:10 | 62K | |
| Fischer Esterificati..> | 2025-09-08 18:10 | 21K | |
| Fischer Esterificati..> | 2025-09-08 18:10 | 65K | |
| Fischer Esterificati..> | 2025-09-08 18:10 | 14K | |
| Fischer Esterificati..> | 2025-09-08 18:10 | 66K | |
| Fischer Esterificati..> | 2025-09-08 18:09 | 15K | |
| Fischer Esterificati..> | 2025-09-08 18:09 | 67K | |
| Fischer Esterificati..> | 2025-09-08 18:09 | 15K | |
| Extraction Procedure..> | 2025-09-08 18:09 | 114K | |
| Extraction Procedure..> | 2025-09-08 18:09 | 80K | |
| Extraction Procedure..> | 2025-09-08 18:09 | 79K | |
| Electrophilic Aromat..> | 2025-09-08 18:09 | 51K | |
| EAS 128L.pdf | 2025-09-08 18:09 | 113K | |
| EAS 128L.docx | 2025-09-08 18:09 | 19K | |
| EAS 128L old.docx | 2025-09-08 18:09 | 19K | |
| Distillation Printab..> | 2025-09-08 18:09 | 481K | |
| Column Chromatograph..> | 2025-09-08 18:09 | 190K | |
| Dehydrobromination.pdf | 2025-09-08 18:09 | 136K | |
| Dehydrobromination.docx | 2025-09-08 18:09 | 249K | |
| Dehydration of Cyclo..> | 2025-09-08 18:09 | 11K | |
| Dehydration of Cyclo..> | 2025-09-08 18:09 | 16K | |
| Dehydration of 2-Met..> | 2025-09-08 18:09 | 16K | |
| Column Chromatograph..> | 2025-09-08 18:09 | 341K | |
| Bromination of Arene..> | 2025-09-08 18:09 | 30K | |
| Bromination of Arene..> | 2025-09-08 18:09 | 30K | |
| Bromination of Arene..> | 2025-09-08 18:09 | 15K | |
| Bromination of Arene..> | 2025-09-08 18:09 | 15K | |
| Azo Violet.docx | 2025-09-08 18:09 | 15K | |
| Azo Violet Multistep..> | 2025-09-08 18:09 | 17K | |
| Azo Violet 220c.pdf | 2025-09-08 18:09 | 12K | |
| Azo Violet 220c.docx | 2025-09-08 18:09 | 15K | |
| Aldol Condensation.pdf | 2025-09-08 18:09 | 9.9K | |
| Aldol Condensation.docx | 2025-09-08 18:09 | 15K | |
| 9-fluorenone.pdf | 2025-09-08 18:09 | 47K | |